C52H40O7 — CID 25266150
[26,28-dibenzoyloxy-27-hydroxy-11-[(E)-prop-1-enyl]-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] benzoate (PubChem CID 25266150) has the molecular formula C52H40O7 and a molecular weight of 776.89 g/mol. Its IUPAC name is [26,28-dibenzoyloxy-27-hydroxy-11-[(E)-prop-1-enyl]-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] benzoate.
| Compound Name | [26,28-dibenzoyloxy-27-hydroxy-11-[(E)-prop-1-enyl]-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] benzoate |
|---|---|
| PubChem CID | 25266150 |
| Molecular Formula | C52H40O7 |
| Molecular Weight | 776.89 g/mol |
| Exact Mass | 776.28 |
| IUPAC Name | [26,28-dibenzoyloxy-27-hydroxy-11-[(E)-prop-1-enyl]-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaenyl] benzoate |
| SMILES | C/C=C/c1cc2c(O)c(c1)Cc1cccc(c1OC(=O)c1ccccc1)Cc1cccc(c1OC(=O)c1ccccc1)Cc1cccc(c1OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C52H40O7/c1-2-15-34-28-44-32-42-26-13-24-40(48(42)58-51(55)36-18-8-4-9-19-36)30-38-22-12-23-39(47(38)57-50(54)35-16-6-3-7-17-35)31-41-25-14-27-43(33-45(29-34)46(44)53)49(41)59-52(56)37-20-10-5-11-21-37/h2-29,53H,30-33H2,1H3/b15-2+ |
| InChIKey | LLQCDUQLXLYMLE-RSSMCMFDSA-N |
| XLogP | 10.76 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.89 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|