C42H37NO8 — CID 102124313
[27-hydroxy-28-(2-methylpropanoyloxy)-5-nitro-26-prop-2-enoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl] benzoate (PubChem CID 102124313) has the molecular formula C42H37NO8 and a molecular weight of 683.76 g/mol. Its IUPAC name is [27-hydroxy-28-(2-methylpropanoyloxy)-5-nitro-26-prop-2-enoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl] benzoate.
| Compound Name | [27-hydroxy-28-(2-methylpropanoyloxy)-5-nitro-26-prop-2-enoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl] benzoate |
|---|---|
| PubChem CID | 102124313 |
| Molecular Formula | C42H37NO8 |
| Molecular Weight | 683.76 g/mol |
| Exact Mass | 683.25 |
| IUPAC Name | [27-hydroxy-28-(2-methylpropanoyloxy)-5-nitro-26-prop-2-enoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl] benzoate |
| SMILES | C=CCOc1c2cccc1Cc1cccc(c1OC(=O)c1ccccc1)Cc1cc([N+](=O)[O-])cc(c1OC(=O)C(C)C)Cc1cccc(c1O)C2 |
| InChI | InChI=1S/C42H37NO8/c1-4-19-49-38-30-15-9-16-31(38)22-32-17-10-18-33(39(32)51-42(46)27-11-6-5-7-12-27)23-35-25-36(43(47)48)24-34(40(35)50-41(45)26(2)3)21-29-14-8-13-28(20-30)37(29)44/h4-18,24-26,44H,1,19-23H2,2-3H3 |
| InChIKey | FHTQEIFETQPJOK-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.76 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|