C49H47NO7 — CID 15444483
17-nitro-26,28-bis(phenylmethoxy)-25,27-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-5-carbaldehyde (PubChem CID 15444483) has the molecular formula C49H47NO7 and a molecular weight of 761.91 g/mol. Its IUPAC name is 17-nitro-26,28-bis(phenylmethoxy)-25,27-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-5-carbaldehyde.
| Compound Name | 17-nitro-26,28-bis(phenylmethoxy)-25,27-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-5-carbaldehyde |
|---|---|
| PubChem CID | 15444483 |
| Molecular Formula | C49H47NO7 |
| Molecular Weight | 761.91 g/mol |
| Exact Mass | 761.34 |
| IUPAC Name | 17-nitro-26,28-bis(phenylmethoxy)-25,27-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-5-carbaldehyde |
| SMILES | CCCOc1c2cccc1Cc1cc([N+](=O)[O-])cc(c1OCc1ccccc1)Cc1cccc(c1OCCC)Cc1cc(C=O)cc(c1OCc1ccccc1)C2 |
| InChI | InChI=1S/C49H47NO7/c1-3-21-54-46-37-17-11-19-39(46)27-43-29-45(50(52)53)30-44(49(43)57-33-35-15-9-6-10-16-35)28-40-20-12-18-38(47(40)55-22-4-2)26-42-24-36(31-51)23-41(25-37)48(42)56-32-34-13-7-5-8-14-34/h5-20,23-24,29-31H,3-4,21-22,25-28,32-33H2,1-2H3 |
| InChIKey | BSLIVELTDLAOGP-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.91 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|