C48H62N2O10 — CID 11535184
11,23-dinitro-25,26,27,28-tetrapentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,17-diol (PubChem CID 11535184) has the molecular formula C48H62N2O10 and a molecular weight of 827.03 g/mol. Its IUPAC name is 11,23-dinitro-25,26,27,28-tetrapentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,17-diol.
| Compound Name | 11,23-dinitro-25,26,27,28-tetrapentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,17-diol |
|---|---|
| PubChem CID | 11535184 |
| Molecular Formula | C48H62N2O10 |
| Molecular Weight | 827.03 g/mol |
| Exact Mass | 826.44 |
| IUPAC Name | 11,23-dinitro-25,26,27,28-tetrapentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,17-diol |
| SMILES | CCCCCOc1c2cc(O)cc1Cc1cc([N+](=O)[O-])cc(c1OCCCCC)Cc1cc(O)cc(c1OCCCCC)Cc1cc([N+](=O)[O-])cc(c1OCCCCC)C2 |
| InChI | InChI=1S/C48H62N2O10/c1-5-9-13-17-57-45-33-21-37-29-43(51)31-39(47(37)59-19-15-11-7-3)23-35-27-42(50(55)56)28-36(46(35)58-18-14-10-6-2)24-40-32-44(52)30-38(48(40)60-20-16-12-8-4)22-34(45)26-41(25-33)49(53)54/h25-32,51-52H,5-24H2,1-4H3 |
| InChIKey | FUKVUJNXKUOAMR-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 163.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.03 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|