C56H78N2O8 — CID 10819577
5,17-ditert-butyl-26,28-didecoxy-11,23-dinitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol (PubChem CID 10819577) has the molecular formula C56H78N2O8 and a molecular weight of 907.25 g/mol. Its IUPAC name is 5,17-ditert-butyl-26,28-didecoxy-11,23-dinitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol.
| Compound Name | 5,17-ditert-butyl-26,28-didecoxy-11,23-dinitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 10819577 |
| Molecular Formula | C56H78N2O8 |
| Molecular Weight | 907.25 g/mol |
| Exact Mass | 906.58 |
| IUPAC Name | 5,17-ditert-butyl-26,28-didecoxy-11,23-dinitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol |
| SMILES | CCCCCCCCCCOc1c2cc(C(C)(C)C)cc1Cc1cc([N+](=O)[O-])cc(c1O)Cc1cc(C(C)(C)C)cc(c1OCCCCCCCCCC)Cc1cc([N+](=O)[O-])cc(c1O)C2 |
| InChI | InChI=1S/C56H78N2O8/c1-9-11-13-15-17-19-21-23-25-65-53-43-27-39-35-49(57(61)62)37-41(51(39)59)29-45-33-48(56(6,7)8)34-46(54(45)66-26-24-22-20-18-16-14-12-10-2)30-42-38-50(58(63)64)36-40(52(42)60)28-44(53)32-47(31-43)55(3,4)5/h31-38,59-60H,9-30H2,1-8H3 |
| InChIKey | XPXZXBZLUFVEGZ-UHFFFAOYSA-N |
| XLogP | 15.22 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.25 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|