C42H54N2O4 — CID 121199159
17,23-diamino-5,11-ditert-butyl-27,28-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-25,26-diol (PubChem CID 121199159) has the molecular formula C42H54N2O4 and a molecular weight of 650.90 g/mol. Its IUPAC name is 17,23-diamino-5,11-ditert-butyl-27,28-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-25,26-diol.
| Compound Name | 17,23-diamino-5,11-ditert-butyl-27,28-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-25,26-diol |
|---|---|
| PubChem CID | 121199159 |
| Molecular Formula | C42H54N2O4 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.41 |
| IUPAC Name | 17,23-diamino-5,11-ditert-butyl-27,28-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-25,26-diol |
| SMILES | CCCOc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1OCCC)Cc1cc(N)cc(c1O)Cc1cc(N)cc(c1O)C2 |
| InChI | InChI=1S/C42H54N2O4/c1-9-11-47-39-29-14-27-23-35(43)21-25(37(27)45)13-26-22-36(44)24-28(38(26)46)15-30-18-34(42(6,7)8)20-32(40(30)48-12-10-2)16-31(39)19-33(17-29)41(3,4)5/h17-24,45-46H,9-16,43-44H2,1-8H3 |
| InChIKey | ZKCYPLDUOJPLAI-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|