C48H64O5 — CID 102046932
5,11,17,23-tetratert-butyl-28-(2-ethoxyethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27-triol (PubChem CID 102046932) has the molecular formula C48H64O5 and a molecular weight of 721.03 g/mol. Its IUPAC name is 5,11,17,23-tetratert-butyl-28-(2-ethoxyethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27-triol.
| Compound Name | 5,11,17,23-tetratert-butyl-28-(2-ethoxyethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27-triol |
|---|---|
| PubChem CID | 102046932 |
| Molecular Formula | C48H64O5 |
| Molecular Weight | 721.03 g/mol |
| Exact Mass | 720.48 |
| IUPAC Name | 5,11,17,23-tetratert-butyl-28-(2-ethoxyethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27-triol |
| SMILES | CCOCCOc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)C2 |
| InChI | InChI=1S/C48H64O5/c1-14-52-15-16-53-44-35-19-33-25-38(46(5,6)7)23-31(42(33)50)17-29-21-37(45(2,3)4)22-30(41(29)49)18-32-24-39(47(8,9)10)26-34(43(32)51)20-36(44)28-40(27-35)48(11,12)13/h21-28,49-51H,14-20H2,1-13H3 |
| InChIKey | CXADMGHYIDPXHW-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.03 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|