C52H74N2O6 — CID 85470956
26,28-bis[2-(2-aminoethoxy)ethoxy]-5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol (PubChem CID 85470956) has the molecular formula C52H74N2O6 and a molecular weight of 823.17 g/mol. Its IUPAC name is 26,28-bis[2-(2-aminoethoxy)ethoxy]-5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol.
| Compound Name | 26,28-bis[2-(2-aminoethoxy)ethoxy]-5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 85470956 |
| Molecular Formula | C52H74N2O6 |
| Molecular Weight | 823.17 g/mol |
| Exact Mass | 822.55 |
| IUPAC Name | 26,28-bis[2-(2-aminoethoxy)ethoxy]-5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1OCCOCCN)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1OCCOCCN)C2 |
| InChI | InChI=1S/C52H74N2O6/c1-49(2,3)41-25-33-21-37-29-43(51(7,8)9)31-39(47(37)59-19-17-57-15-13-53)23-35-27-42(50(4,5)6)28-36(46(35)56)24-40-32-44(52(10,11)12)30-38(22-34(26-41)45(33)55)48(40)60-20-18-58-16-14-54/h25-32,55-56H,13-24,53-54H2,1-12H3 |
| InChIKey | ISGBBEIGRQSGTC-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.17 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|