C36H40O18S4 — CID 11804038
25,27-bis(2-ethoxyethoxy)-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid (PubChem CID 11804038) has the molecular formula C36H40O18S4 and a molecular weight of 888.97 g/mol. Its IUPAC name is 25,27-bis(2-ethoxyethoxy)-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid.
| Compound Name | 25,27-bis(2-ethoxyethoxy)-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid |
|---|---|
| PubChem CID | 11804038 |
| Molecular Formula | C36H40O18S4 |
| Molecular Weight | 888.97 g/mol |
| Exact Mass | 888.11 |
| IUPAC Name | 25,27-bis(2-ethoxyethoxy)-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid |
| SMILES | CCOCCOc1c2cc(S(=O)(=O)O)cc1Cc1cc(S(=O)(=O)O)cc(c1O)Cc1cc(S(=O)(=O)O)cc(c1OCCOCC)Cc1cc(S(=O)(=O)O)cc(c1O)C2 |
| InChI | InChI=1S/C36H40O18S4/c1-3-51-5-7-53-35-25-9-21-13-29(55(39,40)41)15-23(33(21)37)11-27-19-32(58(48,49)50)20-28(36(27)54-8-6-52-4-2)12-24-16-30(56(42,43)44)14-22(34(24)38)10-26(35)18-31(17-25)57(45,46)47/h13-20,37-38H,3-12H2,1-2H3,(H,39,40,41)(H,42,43,44)(H,45,46,47)(H,48,49,50) |
| InChIKey | DVAFRHSQVITIGE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 294.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|