C50H54N2O4 — CID 101407138
11,23-diamino-5,17-ditert-butyl-26,28-bis(phenylmethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol (PubChem CID 101407138) has the molecular formula C50H54N2O4 and a molecular weight of 746.99 g/mol. Its IUPAC name is 11,23-diamino-5,17-ditert-butyl-26,28-bis(phenylmethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol.
| Compound Name | 11,23-diamino-5,17-ditert-butyl-26,28-bis(phenylmethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 101407138 |
| Molecular Formula | C50H54N2O4 |
| Molecular Weight | 746.99 g/mol |
| Exact Mass | 746.41 |
| IUPAC Name | 11,23-diamino-5,17-ditert-butyl-26,28-bis(phenylmethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol |
| SMILES | CC(C)(C)c1cc2c(OCc3ccccc3)c(c1)Cc1cc(N)cc(c1O)Cc1cc(C(C)(C)C)cc(c1OCc1ccccc1)Cc1cc(N)cc(c1O)C2 |
| InChI | InChI=1S/C50H54N2O4/c1-49(2,3)41-21-37-17-33-25-43(51)27-35(45(33)53)19-39-23-42(50(4,5)6)24-40(48(39)56-30-32-15-11-8-12-16-32)20-36-28-44(52)26-34(46(36)54)18-38(22-41)47(37)55-29-31-13-9-7-10-14-31/h7-16,21-28,53-54H,17-20,29-30,51-52H2,1-6H3 |
| InChIKey | KYTUOQJNHJVFHF-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.99 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|