C57H66O3S3 — CID 102372939
7,15,23-tritert-butyl-25,26,27-tris(phenylmethoxy)-3,11,19-trithiatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene (PubChem CID 102372939) has the molecular formula C57H66O3S3 and a molecular weight of 895.35 g/mol. Its IUPAC name is 7,15,23-tritert-butyl-25,26,27-tris(phenylmethoxy)-3,11,19-trithiatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene.
| Compound Name | 7,15,23-tritert-butyl-25,26,27-tris(phenylmethoxy)-3,11,19-trithiatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene |
|---|---|
| PubChem CID | 102372939 |
| Molecular Formula | C57H66O3S3 |
| Molecular Weight | 895.35 g/mol |
| Exact Mass | 894.42 |
| IUPAC Name | 7,15,23-tritert-butyl-25,26,27-tris(phenylmethoxy)-3,11,19-trithiatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene |
| SMILES | CC(C)(C)c1cc2c(OCc3ccccc3)c(c1)CSCc1cc(C(C)(C)C)cc(c1OCc1ccccc1)CSCc1cc(C(C)(C)C)cc(c1OCc1ccccc1)CSC2 |
| InChI | InChI=1S/C57H66O3S3/c1-55(2,3)49-25-43-34-61-36-45-27-50(56(4,5)6)29-47(53(45)59-32-41-21-15-11-16-22-41)38-63-39-48-30-51(57(7,8)9)28-46(54(48)60-33-42-23-17-12-18-24-42)37-62-35-44(26-49)52(43)58-31-40-19-13-10-14-20-40/h10-30H,31-39H2,1-9H3 |
| InChIKey | ZDBZQLRJKIRBDO-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.35 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |