C58H68O4 — CID 11388780
5,11,17,23-tetratert-butyl-27,28-bis(phenylmethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,26-diol (PubChem CID 11388780) has the molecular formula C58H68O4 and a molecular weight of 829.18 g/mol. Its IUPAC name is 5,11,17,23-tetratert-butyl-27,28-bis(phenylmethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,26-diol.
| Compound Name | 5,11,17,23-tetratert-butyl-27,28-bis(phenylmethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,26-diol |
|---|---|
| PubChem CID | 11388780 |
| Molecular Formula | C58H68O4 |
| Molecular Weight | 829.18 g/mol |
| Exact Mass | 828.51 |
| IUPAC Name | 5,11,17,23-tetratert-butyl-27,28-bis(phenylmethoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,26-diol |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1OCc1ccccc1)Cc1cc(C(C)(C)C)cc(c1OCc1ccccc1)Cc1cc(C(C)(C)C)cc(c1O)C2 |
| InChI | InChI=1S/C58H68O4/c1-55(2,3)47-27-39-23-40-28-48(56(4,5)6)30-42(52(40)60)25-44-32-50(58(10,11)12)34-46(54(44)62-36-38-21-17-14-18-22-38)26-45-33-49(57(7,8)9)31-43(24-41(29-47)51(39)59)53(45)61-35-37-19-15-13-16-20-37/h13-22,27-34,59-60H,23-26,35-36H2,1-12H3 |
| InChIKey | QWEBNBQNAQLTRC-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.18 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |