C26H36O2S2 — CID 12707941
7,15-ditert-butyl-17,18-dimethoxy-3,11-dithiatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene (PubChem CID 12707941) has the molecular formula C26H36O2S2 and a molecular weight of 444.71 g/mol. Its IUPAC name is 7,15-ditert-butyl-17,18-dimethoxy-3,11-dithiatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene.
| Compound Name | 7,15-ditert-butyl-17,18-dimethoxy-3,11-dithiatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene |
|---|---|
| PubChem CID | 12707941 |
| Molecular Formula | C26H36O2S2 |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 7,15-ditert-butyl-17,18-dimethoxy-3,11-dithiatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene |
| SMILES | COc1c2cc(C(C)(C)C)cc1CSCc1cc(C(C)(C)C)cc(c1OC)CSC2 |
| InChI | InChI=1S/C26H36O2S2/c1-25(2,3)21-9-17-13-29-15-19-11-22(26(4,5)6)12-20(24(19)28-8)16-30-14-18(10-21)23(17)27-7/h9-12H,13-16H2,1-8H3 |
| InChIKey | OKOKHOGERKPTDO-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |