C46H58OSi — CID 101076218
5,11,17,23-tetratert-butyl-29-methoxy-1-methyl-1-silaheptacyclo[13.11.1.13,25.19,13.02,7.019,27.021,26]nonacosa-2(7),3,5,9,11,13(29),15(27),16,18,21(26),22,24-dodecaene (PubChem CID 101076218) has the molecular formula C46H58OSi and a molecular weight of 655.06 g/mol. Its IUPAC name is 5,11,17,23-tetratert-butyl-29-methoxy-1-methyl-1-silaheptacyclo[13.11.1.13,25.19,13.02,7.019,27.021,26]nonacosa-2(7),3,5,9,11,13(29),15(27),16,18,21(26),22,24-dodecaene.
| Compound Name | 5,11,17,23-tetratert-butyl-29-methoxy-1-methyl-1-silaheptacyclo[13.11.1.13,25.19,13.02,7.019,27.021,26]nonacosa-2(7),3,5,9,11,13(29),15(27),16,18,21(26),22,24-dodecaene |
|---|---|
| PubChem CID | 101076218 |
| Molecular Formula | C46H58OSi |
| Molecular Weight | 655.06 g/mol |
| Exact Mass | 654.43 |
| IUPAC Name | 5,11,17,23-tetratert-butyl-29-methoxy-1-methyl-1-silaheptacyclo[13.11.1.13,25.19,13.02,7.019,27.021,26]nonacosa-2(7),3,5,9,11,13(29),15(27),16,18,21(26),22,24-dodecaene |
| SMILES | COc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc3c1[Si]1(C)c4c(cc(C(C)(C)C)cc4Cc4cc(C(C)(C)C)cc(c41)C3)C2 |
| InChI | InChI=1S/C46H58OSi/c1-43(2,3)35-19-27-15-29-21-36(44(4,5)6)23-31-17-33-25-38(46(10,11)12)26-34-18-32-24-37(45(7,8)9)22-30(16-28(20-35)39(27)47-13)41(32)48(14,40(29)31)42(33)34/h19-26H,15-18H2,1-14H3 |
| InChIKey | OHDPBNAUKXFGIE-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.06 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|