C40H56O3 — CID 15320227
6,13,21-tritert-butyl-23,24,25-trimethoxytetracyclo[17.3.1.14,8.111,15]pentacosa-1(22),4,6,8(25),11,13,15(24),19(23),20-nonaene (PubChem CID 15320227) has the molecular formula C40H56O3 and a molecular weight of 584.89 g/mol. Its IUPAC name is 6,13,21-tritert-butyl-23,24,25-trimethoxytetracyclo[17.3.1.14,8.111,15]pentacosa-1(22),4,6,8(25),11,13,15(24),19(23),20-nonaene.
| Compound Name | 6,13,21-tritert-butyl-23,24,25-trimethoxytetracyclo[17.3.1.14,8.111,15]pentacosa-1(22),4,6,8(25),11,13,15(24),19(23),20-nonaene |
|---|---|
| PubChem CID | 15320227 |
| Molecular Formula | C40H56O3 |
| Molecular Weight | 584.89 g/mol |
| Exact Mass | 584.42 |
| IUPAC Name | 6,13,21-tritert-butyl-23,24,25-trimethoxytetracyclo[17.3.1.14,8.111,15]pentacosa-1(22),4,6,8(25),11,13,15(24),19(23),20-nonaene |
| SMILES | COc1c2cc(C(C)(C)C)cc1CCc1cc(C(C)(C)C)cc(c1OC)CCc1cc(C(C)(C)C)cc(c1OC)CCC2 |
| InChI | InChI=1S/C40H56O3/c1-38(2,3)32-20-26-14-13-15-27-21-33(39(4,5)6)23-29(36(27)42-11)17-19-31-25-34(40(7,8)9)24-30(37(31)43-12)18-16-28(22-32)35(26)41-10/h20-25H,13-19H2,1-12H3 |
| InChIKey | JXTONKSUNJNZRD-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.89 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |