C36H54O2 — CID 102572261
(2Z)-6,21-ditert-butyl-23,24-dimethoxy-2,3-dimethyltricyclo[17.3.1.14,8]tetracosa-1(22),2,4,6,8(24),19(23),20-heptaene (PubChem CID 102572261) has the molecular formula C36H54O2 and a molecular weight of 518.83 g/mol. Its IUPAC name is (2Z)-6,21-ditert-butyl-23,24-dimethoxy-2,3-dimethyltricyclo[17.3.1.14,8]tetracosa-1(22),2,4,6,8(24),19(23),20-heptaene.
| Compound Name | (2Z)-6,21-ditert-butyl-23,24-dimethoxy-2,3-dimethyltricyclo[17.3.1.14,8]tetracosa-1(22),2,4,6,8(24),19(23),20-heptaene |
|---|---|
| PubChem CID | 102572261 |
| Molecular Formula | C36H54O2 |
| Molecular Weight | 518.83 g/mol |
| Exact Mass | 518.41 |
| IUPAC Name | (2Z)-6,21-ditert-butyl-23,24-dimethoxy-2,3-dimethyltricyclo[17.3.1.14,8]tetracosa-1(22),2,4,6,8(24),19(23),20-heptaene |
| SMILES | COc1c2cc(C(C)(C)C)cc1/C(C)=C(/C)c1cc(C(C)(C)C)cc(c1OC)CCCCCCCCCC2 |
| InChI | InChI=1S/C36H54O2/c1-25-26(2)32-24-30(36(6,7)8)22-28(34(32)38-10)20-18-16-14-12-11-13-15-17-19-27-21-29(35(3,4)5)23-31(25)33(27)37-9/h21-24H,11-20H2,1-10H3/b26-25- |
| InChIKey | VQGSRYKTWSOPDB-QPLCGJKRSA-N |
| XLogP | 10.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.83 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|