C30H40O2S — CID 102076237
(24Z)-17,23-dimethoxy-24,25-dimethyl-20-thiatetracyclo[14.7.2.13,22.114,18]heptacosa-1,3(26),14(27),15,17,22,24-heptaene (PubChem CID 102076237) has the molecular formula C30H40O2S and a molecular weight of 464.72 g/mol. Its IUPAC name is (24Z)-17,23-dimethoxy-24,25-dimethyl-20-thiatetracyclo[14.7.2.13,22.114,18]heptacosa-1,3(26),14(27),15,17,22,24-heptaene.
| Compound Name | (24Z)-17,23-dimethoxy-24,25-dimethyl-20-thiatetracyclo[14.7.2.13,22.114,18]heptacosa-1,3(26),14(27),15,17,22,24-heptaene |
|---|---|
| PubChem CID | 102076237 |
| Molecular Formula | C30H40O2S |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (24Z)-17,23-dimethoxy-24,25-dimethyl-20-thiatetracyclo[14.7.2.13,22.114,18]heptacosa-1,3(26),14(27),15,17,22,24-heptaene |
| SMILES | COc1c2cc3cc1/C(C)=C(/C)c1cc(cc(c1OC)CSC2)CCCCCCCCCC3 |
| InChI | InChI=1S/C30H40O2S/c1-21-22(2)28-18-24-14-12-10-8-6-5-7-9-11-13-23-15-25(29(31-3)27(21)17-23)19-33-20-26(16-24)30(28)32-4/h15-18H,5-14,19-20H2,1-4H3/b22-21- |
| InChIKey | QKSSIXCKGRWZEZ-DQRAZIAOSA-N |
| XLogP | 8.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|