C30H44S — CID 10433185
7,18-ditert-butyl-20,21-dimethyl-3-thiatricyclo[14.3.1.15,9]henicosa-1(19),5,7,9(21),16(20),17-hexaene (PubChem CID 10433185) has the molecular formula C30H44S and a molecular weight of 436.75 g/mol. Its IUPAC name is 7,18-ditert-butyl-20,21-dimethyl-3-thiatricyclo[14.3.1.15,9]henicosa-1(19),5,7,9(21),16(20),17-hexaene.
| Compound Name | 7,18-ditert-butyl-20,21-dimethyl-3-thiatricyclo[14.3.1.15,9]henicosa-1(19),5,7,9(21),16(20),17-hexaene |
|---|---|
| PubChem CID | 10433185 |
| Molecular Formula | C30H44S |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 7,18-ditert-butyl-20,21-dimethyl-3-thiatricyclo[14.3.1.15,9]henicosa-1(19),5,7,9(21),16(20),17-hexaene |
| SMILES | Cc1c2cc(C(C)(C)C)cc1CSCc1cc(C(C)(C)C)cc(c1C)CCCCCC2 |
| InChI | InChI=1S/C30H44S/c1-21-23-13-11-9-10-12-14-24-16-28(30(6,7)8)18-26(22(24)2)20-31-19-25(21)17-27(15-23)29(3,4)5/h15-18H,9-14,19-20H2,1-8H3 |
| InChIKey | OEFMGASBWHODIU-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |