C48H64O4 — CID 12707932
6,13,20,27-tetratert-butylpentacyclo[23.3.1.14,8.111,15.118,22]dotriaconta-1(28),4,6,8(32),11,13,15(31),18(30),19,21,25(29),26-dodecaene-29,30,31,32-tetrol (PubChem CID 12707932) has the molecular formula C48H64O4 and a molecular weight of 705.04 g/mol. Its IUPAC name is 6,13,20,27-tetratert-butylpentacyclo[23.3.1.14,8.111,15.118,22]dotriaconta-1(28),4,6,8(32),11,13,15(31),18(30),19,21,25(29),26-dodecaene-29,30,31,32-tetrol.
| Compound Name | 6,13,20,27-tetratert-butylpentacyclo[23.3.1.14,8.111,15.118,22]dotriaconta-1(28),4,6,8(32),11,13,15(31),18(30),19,21,25(29),26-dodecaene-29,30,31,32-tetrol |
|---|---|
| PubChem CID | 12707932 |
| Molecular Formula | C48H64O4 |
| Molecular Weight | 705.04 g/mol |
| Exact Mass | 704.48 |
| IUPAC Name | 6,13,20,27-tetratert-butylpentacyclo[23.3.1.14,8.111,15.118,22]dotriaconta-1(28),4,6,8(32),11,13,15(31),18(30),19,21,25(29),26-dodecaene-29,30,31,32-tetrol |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)CCc1cc(C(C)(C)C)cc(c1O)CCc1cc(C(C)(C)C)cc(c1O)CCc1cc(C(C)(C)C)cc(c1O)CC2 |
| InChI | InChI=1S/C48H64O4/c1-45(2,3)37-21-29-13-15-31-23-38(46(4,5)6)25-33(42(31)50)17-19-35-27-40(48(10,11)12)28-36(44(35)52)20-18-34-26-39(47(7,8)9)24-32(43(34)51)16-14-30(22-37)41(29)49/h21-28,49-52H,13-20H2,1-12H3 |
| InChIKey | ZMVFQYOPIVBZQY-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.04 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |