C44H56O2 — CID 14714984
5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol (PubChem CID 14714984) has the molecular formula C44H56O2 and a molecular weight of 616.93 g/mol. Its IUPAC name is 5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol.
| Compound Name | 5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 14714984 |
| Molecular Formula | C44H56O2 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.43 |
| IUPAC Name | 5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol |
| SMILES | CC(C)(C)c1cc2cc(c1)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(cc(C(C)(C)C)c1)Cc1cc(C(C)(C)C)cc(c1O)C2 |
| InChI | InChI=1S/C44H56O2/c1-41(2,3)35-19-27-13-28(20-35)16-32-24-38(44(10,11)12)26-34(40(32)46)18-30-14-29(21-36(22-30)42(4,5)6)17-33-25-37(43(7,8)9)23-31(15-27)39(33)45/h13-14,19-26,45-46H,15-18H2,1-12H3 |
| InChIKey | XHHYEHPJVYXDGQ-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |