C32H32O4 — CID 10767079
5-tert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol (PubChem CID 10767079) has the molecular formula C32H32O4 and a molecular weight of 480.60 g/mol. Its IUPAC name is 5-tert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol.
| Compound Name | 5-tert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol |
|---|---|
| PubChem CID | 10767079 |
| Molecular Formula | C32H32O4 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 5-tert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cccc(c1O)Cc1cccc(c1O)Cc1cccc(c1O)C2 |
| InChI | InChI=1S/C32H32O4/c1-32(2,3)27-17-25-15-23-11-5-9-21(29(23)34)13-19-7-4-8-20(28(19)33)14-22-10-6-12-24(30(22)35)16-26(18-27)31(25)36/h4-12,17-18,33-36H,13-16H2,1-3H3 |
| InChIKey | PGGDQQBWFYACMG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |