About 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene
9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene (PubChem CID 15321172) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene.
Analyze 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene?
The IUPAC name of 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene (CID 15321172) is 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene.
What is the SMILES notation for 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene?
The canonical SMILES for 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene is Cc1c2ccc(c1C)CCCCCC2.
What is the InChIKey of 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene?
The InChIKey is ARNPIKHROGGTJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20/c1-11-12(2)14-8-6-4-3-5-7-13(11)9-10-14/h9-10H,3-8H2,1-2H3.
What are the key properties of 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene?
9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene has a molecular weight of 188.31 g/mol, XLogP of 3.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dimethylbicyclo[6.2.2]dodeca-1(10),8,11-triene is sourced from PubChem (CID 15321172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).