C19H34 — CID 142513105
ethane;methane;9-methyl-1,2,3,4,5,6,7,8-octahydroanthracene (PubChem CID 142513105) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is ethane;methane;9-methyl-1,2,3,4,5,6,7,8-octahydroanthracene.
| Compound Name | ethane;methane;9-methyl-1,2,3,4,5,6,7,8-octahydroanthracene |
|---|---|
| PubChem CID | 142513105 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | ethane;methane;9-methyl-1,2,3,4,5,6,7,8-octahydroanthracene |
| SMILES | C.C.CC.Cc1c2c(cc3c1CCCC3)CCCC2 |
| InChI | InChI=1S/C15H20.C2H6.2CH4/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;1-2;;/h10H,2-9H2,1H3;1-2H3;2*1H4 |
| InChIKey | LRMQJLYPSAAJQL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |