C18H21N — CID 141108948
2-methyl-3-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)aniline (PubChem CID 141108948) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-methyl-3-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)aniline.
| Compound Name | 2-methyl-3-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)aniline |
|---|---|
| PubChem CID | 141108948 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-methyl-3-(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)aniline |
| SMILES | Cc1c(N)cccc1-c1ccc2c(c1C)CCCC2 |
| InChI | InChI=1S/C18H21N/c1-12-15-7-4-3-6-14(15)10-11-17(12)16-8-5-9-18(19)13(16)2/h5,8-11H,3-4,6-7,19H2,1-2H3 |
| InChIKey | NNSIOLBLLAPRGQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|