About 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine
2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine (PubChem CID 174754573) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine |
| PubChem CID | 174754573 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine |
| SMILES | CN(C)C.Nc1cccc2c1CCC2 |
| InChI | InChI=1S/C9H11N.C3H9N/c10-9-6-2-4-7-3-1-5-8(7)9;1-4(2)3/h2,4,6H,1,3,5,10H2;1-3H3 |
| InChIKey | WFRJJLZOZDREQS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine?
The IUPAC name of 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine (CID 174754573) is 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine.
What is the SMILES notation for 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine?
The canonical SMILES for 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine is CN(C)C.Nc1cccc2c1CCC2.
What is the InChIKey of 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine?
The InChIKey is WFRJJLZOZDREQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.C3H9N/c10-9-6-2-4-7-3-1-5-8(7)9;1-4(2)3/h2,4,6H,1,3,5,10H2;1-3H3.
What are the key properties of 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine?
2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine has a molecular weight of 192.31 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine is sourced from PubChem (CID 174754573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).