C12H20N2 — CID 174754573
2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine (PubChem CID 174754573) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine.
| Compound Name | 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 174754573 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2,3-dihydro-1H-inden-4-amine;N,N-dimethylmethanamine |
| SMILES | CN(C)C.Nc1cccc2c1CCC2 |
| InChI | InChI=1S/C9H11N.C3H9N/c10-9-6-2-4-7-3-1-5-8(7)9;1-4(2)3/h2,4,6H,1,3,5,10H2;1-3H3 |
| InChIKey | WFRJJLZOZDREQS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|