C12H17O+ — CID 134990036
1,3-dimethyl-6,7,8,9-tetrahydro-5H-cyclohepta[c]pyran-2-ium (PubChem CID 134990036) has the molecular formula C12H17O+ and a molecular weight of 177.27 g/mol. Its IUPAC name is 1,3-dimethyl-6,7,8,9-tetrahydro-5H-cyclohepta[c]pyran-2-ium.
| Compound Name | 1,3-dimethyl-6,7,8,9-tetrahydro-5H-cyclohepta[c]pyran-2-ium |
|---|---|
| PubChem CID | 134990036 |
| Molecular Formula | C12H17O+ |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1,3-dimethyl-6,7,8,9-tetrahydro-5H-cyclohepta[c]pyran-2-ium |
| SMILES | Cc1cc2c(c(C)[o+]1)CCCCC2 |
| InChI | InChI=1S/C12H17O/c1-9-8-11-6-4-3-5-7-12(11)10(2)13-9/h8H,3-7H2,1-2H3/q+1 |
| InChIKey | UWEPPTFMWKEXOB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|