C13H19O+ — CID 134911583
3-methyl-1-propan-2-yl-5,6,7,8-tetrahydroisochromen-2-ium (PubChem CID 134911583) has the molecular formula C13H19O+ and a molecular weight of 191.29 g/mol. Its IUPAC name is 3-methyl-1-propan-2-yl-5,6,7,8-tetrahydroisochromen-2-ium.
| Compound Name | 3-methyl-1-propan-2-yl-5,6,7,8-tetrahydroisochromen-2-ium |
|---|---|
| PubChem CID | 134911583 |
| Molecular Formula | C13H19O+ |
| Molecular Weight | 191.29 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 3-methyl-1-propan-2-yl-5,6,7,8-tetrahydroisochromen-2-ium |
| SMILES | Cc1cc2c(c(C(C)C)[o+]1)CCCC2 |
| InChI | InChI=1S/C13H19O/c1-9(2)13-12-7-5-4-6-11(12)8-10(3)14-13/h8-9H,4-7H2,1-3H3/q+1 |
| InChIKey | BPMVMXKRGVCQFX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|