C12H15BrO — CID 84708520
1-(4-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)ethanol (PubChem CID 84708520) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is 1-(4-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)ethanol.
| Compound Name | 1-(4-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)ethanol |
|---|---|
| PubChem CID | 84708520 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-(4-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)ethanol |
| SMILES | CC(O)c1cc(Br)c2c(c1)CCCC2 |
| InChI | InChI=1S/C12H15BrO/c1-8(14)10-6-9-4-2-3-5-11(9)12(13)7-10/h6-8,14H,2-5H2,1H3 |
| InChIKey | GAOWKBFTZCGTCI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |