C13H15BrO — CID 117421033
3-(7-bromo-2,3-dihydro-1H-inden-5-yl)butanal (PubChem CID 117421033) has the molecular formula C13H15BrO and a molecular weight of 267.17 g/mol. Its IUPAC name is 3-(7-bromo-2,3-dihydro-1H-inden-5-yl)butanal.
| Compound Name | 3-(7-bromo-2,3-dihydro-1H-inden-5-yl)butanal |
|---|---|
| PubChem CID | 117421033 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 3-(7-bromo-2,3-dihydro-1H-inden-5-yl)butanal |
| SMILES | CC(CC=O)c1cc(Br)c2c(c1)CCC2 |
| InChI | InChI=1S/C13H15BrO/c1-9(5-6-15)11-7-10-3-2-4-12(10)13(14)8-11/h6-9H,2-5H2,1H3 |
| InChIKey | BATVQWCUOFQSLI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|