C11H12F2O — CID 117287779
3-(3,4-difluoro-5-methylphenyl)butanal (PubChem CID 117287779) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is 3-(3,4-difluoro-5-methylphenyl)butanal.
| Compound Name | 3-(3,4-difluoro-5-methylphenyl)butanal |
|---|---|
| PubChem CID | 117287779 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-(3,4-difluoro-5-methylphenyl)butanal |
| SMILES | Cc1cc(C(C)CC=O)cc(F)c1F |
| InChI | InChI=1S/C11H12F2O/c1-7(3-4-14)9-5-8(2)11(13)10(12)6-9/h4-7H,3H2,1-2H3 |
| InChIKey | YUFXHRJCSFNURP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|