C13H17FO3 — CID 117353374
3-(2-fluoro-3,4-dimethoxy-5-methylphenyl)butanal (PubChem CID 117353374) has the molecular formula C13H17FO3 and a molecular weight of 240.27 g/mol. Its IUPAC name is 3-(2-fluoro-3,4-dimethoxy-5-methylphenyl)butanal.
| Compound Name | 3-(2-fluoro-3,4-dimethoxy-5-methylphenyl)butanal |
|---|---|
| PubChem CID | 117353374 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 3-(2-fluoro-3,4-dimethoxy-5-methylphenyl)butanal |
| SMILES | COc1c(C)cc(C(C)CC=O)c(F)c1OC |
| InChI | InChI=1S/C13H17FO3/c1-8(5-6-15)10-7-9(2)12(16-3)13(17-4)11(10)14/h6-8H,5H2,1-4H3 |
| InChIKey | SRQFSDQWRTWOBE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|