C11H11BrF2O2 — CID 117472934
3-(5-bromo-3,4-difluoro-2-methoxyphenyl)butanal (PubChem CID 117472934) has the molecular formula C11H11BrF2O2 and a molecular weight of 293.11 g/mol. Its IUPAC name is 3-(5-bromo-3,4-difluoro-2-methoxyphenyl)butanal.
| Compound Name | 3-(5-bromo-3,4-difluoro-2-methoxyphenyl)butanal |
|---|---|
| PubChem CID | 117472934 |
| Molecular Formula | C11H11BrF2O2 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 3-(5-bromo-3,4-difluoro-2-methoxyphenyl)butanal |
| SMILES | COc1c(C(C)CC=O)cc(Br)c(F)c1F |
| InChI | InChI=1S/C11H11BrF2O2/c1-6(3-4-15)7-5-8(12)9(13)10(14)11(7)16-2/h4-6H,3H2,1-2H3 |
| InChIKey | XOABIIMWCCZSSR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|