C12H14F2O — CID 117302967
3-(2,5-difluoro-3,6-dimethylphenyl)butanal (PubChem CID 117302967) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is 3-(2,5-difluoro-3,6-dimethylphenyl)butanal.
| Compound Name | 3-(2,5-difluoro-3,6-dimethylphenyl)butanal |
|---|---|
| PubChem CID | 117302967 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-(2,5-difluoro-3,6-dimethylphenyl)butanal |
| SMILES | Cc1cc(F)c(C)c(C(C)CC=O)c1F |
| InChI | InChI=1S/C12H14F2O/c1-7(4-5-15)11-9(3)10(13)6-8(2)12(11)14/h5-7H,4H2,1-3H3 |
| InChIKey | NHOSPQPFFCGFKS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|