C16H25N — CID 145387694
ethane;ethene;1,2,3,5,6,7-hexahydro-s-indacen-4-amine (PubChem CID 145387694) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is ethane;ethene;1,2,3,5,6,7-hexahydro-s-indacen-4-amine.
| Compound Name | ethane;ethene;1,2,3,5,6,7-hexahydro-s-indacen-4-amine |
|---|---|
| PubChem CID | 145387694 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | ethane;ethene;1,2,3,5,6,7-hexahydro-s-indacen-4-amine |
| SMILES | C=C.CC.Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C12H15N.C2H6.C2H4/c13-12-10-5-1-3-8(10)7-9-4-2-6-11(9)12;2*1-2/h7H,1-6,13H2;1-2H3;1-2H2 |
| InChIKey | LIUZFDUUNBPKAB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|