C13H15N — CID 142522585
5-methylidene-2,3,6,7-tetrahydro-1H-s-indacen-4-amine (PubChem CID 142522585) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 5-methylidene-2,3,6,7-tetrahydro-1H-s-indacen-4-amine.
| Compound Name | 5-methylidene-2,3,6,7-tetrahydro-1H-s-indacen-4-amine |
|---|---|
| PubChem CID | 142522585 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5-methylidene-2,3,6,7-tetrahydro-1H-s-indacen-4-amine |
| SMILES | C=C1CCc2cc3c(c(N)c21)CCC3 |
| InChI | InChI=1S/C13H15N/c1-8-5-6-10-7-9-3-2-4-11(9)13(14)12(8)10/h7H,1-6,14H2 |
| InChIKey | VPLPKPAXRYNQCY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|