C10H12BrN — CID 146380579
5-bromo-6-methyl-2,3-dihydro-1H-inden-4-amine (PubChem CID 146380579) has the molecular formula C10H12BrN and a molecular weight of 226.12 g/mol. Its IUPAC name is 5-bromo-6-methyl-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 5-bromo-6-methyl-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 146380579 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 5-bromo-6-methyl-2,3-dihydro-1H-inden-4-amine |
| SMILES | Cc1cc2c(c(N)c1Br)CCC2 |
| InChI | InChI=1S/C10H12BrN/c1-6-5-7-3-2-4-8(7)10(12)9(6)11/h5H,2-4,12H2,1H3 |
| InChIKey | BDNZTBCACDHZBI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|