C9H9BrFN — CID 170283398
7-bromo-6-fluoro-2,3-dihydro-1H-inden-5-amine (PubChem CID 170283398) has the molecular formula C9H9BrFN and a molecular weight of 230.08 g/mol. Its IUPAC name is 7-bromo-6-fluoro-2,3-dihydro-1H-inden-5-amine.
| Compound Name | 7-bromo-6-fluoro-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 170283398 |
| Molecular Formula | C9H9BrFN |
| Molecular Weight | 230.08 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 7-bromo-6-fluoro-2,3-dihydro-1H-inden-5-amine |
| SMILES | Nc1cc2c(c(Br)c1F)CCC2 |
| InChI | InChI=1S/C9H9BrFN/c10-8-6-3-1-2-5(6)4-7(12)9(8)11/h4H,1-3,12H2 |
| InChIKey | DCEYBQYSXKZTFG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.08 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|