C11H16N2 — CID 130714837
6-[(1R)-1-aminoethyl]-2,3-dihydro-1H-inden-4-amine (PubChem CID 130714837) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 6-[(1R)-1-aminoethyl]-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 6-[(1R)-1-aminoethyl]-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 130714837 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 6-[(1R)-1-aminoethyl]-2,3-dihydro-1H-inden-4-amine |
| SMILES | C[C@@H](N)c1cc(N)c2c(c1)CCC2 |
| InChI | InChI=1S/C11H16N2/c1-7(12)9-5-8-3-2-4-10(8)11(13)6-9/h5-7H,2-4,12-13H2,1H3/t7-/m1/s1 |
| InChIKey | OFSBYWVYTWLYSX-SSDOTTSWSA-N |
| XLogP | 1.78 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|