C11H14ClN — CID 130682579
(1R)-1-(7-chloro-2,3-dihydro-1H-inden-5-yl)ethanamine (PubChem CID 130682579) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is (1R)-1-(7-chloro-2,3-dihydro-1H-inden-5-yl)ethanamine.
| Compound Name | (1R)-1-(7-chloro-2,3-dihydro-1H-inden-5-yl)ethanamine |
|---|---|
| PubChem CID | 130682579 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | (1R)-1-(7-chloro-2,3-dihydro-1H-inden-5-yl)ethanamine |
| SMILES | C[C@@H](N)c1cc(Cl)c2c(c1)CCC2 |
| InChI | InChI=1S/C11H14ClN/c1-7(13)9-5-8-3-2-4-10(8)11(12)6-9/h5-7H,2-4,13H2,1H3/t7-/m1/s1 |
| InChIKey | FXFRQYMUVUEGLW-SSDOTTSWSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |