About 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene
2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene (PubChem CID 170565054) has the molecular formula C11H11Br
and a molecular weight of 223.11 g/mol. Its IUPAC name is 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene.
Molecular Properties
| Compound Name | 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene |
| PubChem CID | 170565054 |
| Molecular Formula | C11H11Br |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene |
| SMILES | Brc1c2c(cc3c1CC3)CCC2 |
| InChI | InChI=1S/C11H11Br/c12-11-9-3-1-2-7(9)6-8-4-5-10(8)11/h6H,1-5H2 |
| InChIKey | XTSIMWOECQZOAJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene?
The IUPAC name of 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene (CID 170565054) is 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene.
What is the SMILES notation for 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene?
The canonical SMILES for 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene is Brc1c2c(cc3c1CC3)CCC2.
What is the InChIKey of 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene?
The InChIKey is XTSIMWOECQZOAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Br/c12-11-9-3-1-2-7(9)6-8-4-5-10(8)11/h6H,1-5H2.
What are the key properties of 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene?
2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene has a molecular weight of 223.11 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromotricyclo[6.3.0.03,6]undeca-1,3(6),7-triene is sourced from PubChem (CID 170565054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).