C10H11BrO — CID 171560787
5-bromo-6-methyl-2,3-dihydro-1H-inden-4-ol (PubChem CID 171560787) has the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. Its IUPAC name is 5-bromo-6-methyl-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 5-bromo-6-methyl-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 171560787 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 5-bromo-6-methyl-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1cc2c(c(O)c1Br)CCC2 |
| InChI | InChI=1S/C10H11BrO/c1-6-5-7-3-2-4-8(7)10(12)9(6)11/h5,12H,2-4H2,1H3 |
| InChIKey | AOEKXTUOLPFGDA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |