C7H6Br2O2 — CID 54013220
3,4-dibromo-5-methylbenzene-1,2-diol (PubChem CID 54013220) has the molecular formula C7H6Br2O2 and a molecular weight of 281.93 g/mol. Its IUPAC name is 3,4-dibromo-5-methylbenzene-1,2-diol.
| Compound Name | 3,4-dibromo-5-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 54013220 |
| Molecular Formula | C7H6Br2O2 |
| Molecular Weight | 281.93 g/mol |
| Exact Mass | 279.87 |
| IUPAC Name | 3,4-dibromo-5-methylbenzene-1,2-diol |
| SMILES | Cc1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C7H6Br2O2/c1-3-2-4(10)7(11)6(9)5(3)8/h2,10-11H,1H3 |
| InChIKey | KTVJTUNMIMYZHR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.93 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|