About 3,4-dibromo-5-methylbenzene-1,2-diol
3,4-dibromo-5-methylbenzene-1,2-diol (PubChem CID 54013220) has the molecular formula C7H6Br2O2
and a molecular weight of 281.93 g/mol. Its IUPAC name is 3,4-dibromo-5-methylbenzene-1,2-diol.
Molecular Properties
| Compound Name | 3,4-dibromo-5-methylbenzene-1,2-diol |
| PubChem CID | 54013220 |
| Molecular Formula | C7H6Br2O2 |
| Molecular Weight | 281.93 g/mol |
| Exact Mass | 279.87 |
| IUPAC Name | 3,4-dibromo-5-methylbenzene-1,2-diol |
| SMILES | Cc1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C7H6Br2O2/c1-3-2-4(10)7(11)6(9)5(3)8/h2,10-11H,1H3 |
| InChIKey | KTVJTUNMIMYZHR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.93 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibromo-5-methylbenzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibromo-5-methylbenzene-1,2-diol?
The IUPAC name of 3,4-dibromo-5-methylbenzene-1,2-diol (CID 54013220) is 3,4-dibromo-5-methylbenzene-1,2-diol.
What is the SMILES notation for 3,4-dibromo-5-methylbenzene-1,2-diol?
The canonical SMILES for 3,4-dibromo-5-methylbenzene-1,2-diol is Cc1cc(O)c(O)c(Br)c1Br.
What is the InChIKey of 3,4-dibromo-5-methylbenzene-1,2-diol?
The InChIKey is KTVJTUNMIMYZHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Br2O2/c1-3-2-4(10)7(11)6(9)5(3)8/h2,10-11H,1H3.
What are the key properties of 3,4-dibromo-5-methylbenzene-1,2-diol?
3,4-dibromo-5-methylbenzene-1,2-diol has a molecular weight of 281.93 g/mol, XLogP of 2.93, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromo-5-methylbenzene-1,2-diol is sourced from PubChem (CID 54013220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).