C10H13BrO3 — CID 117406451
3-bromo-4-(2-hydroxypropyl)-5-methylbenzene-1,2-diol (PubChem CID 117406451) has the molecular formula C10H13BrO3 and a molecular weight of 261.11 g/mol. Its IUPAC name is 3-bromo-4-(2-hydroxypropyl)-5-methylbenzene-1,2-diol.
| Compound Name | 3-bromo-4-(2-hydroxypropyl)-5-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 117406451 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 3-bromo-4-(2-hydroxypropyl)-5-methylbenzene-1,2-diol |
| SMILES | Cc1cc(O)c(O)c(Br)c1CC(C)O |
| InChI | InChI=1S/C10H13BrO3/c1-5-3-8(13)10(14)9(11)7(5)4-6(2)12/h3,6,12-14H,4H2,1-2H3 |
| InChIKey | ZTCCIEUHIKXHQW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|