C9H11FO3 — CID 117280369
4-fluoro-3-(2-hydroxypropyl)benzene-1,2-diol (PubChem CID 117280369) has the molecular formula C9H11FO3 and a molecular weight of 186.18 g/mol. Its IUPAC name is 4-fluoro-3-(2-hydroxypropyl)benzene-1,2-diol.
| Compound Name | 4-fluoro-3-(2-hydroxypropyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 117280369 |
| Molecular Formula | C9H11FO3 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 4-fluoro-3-(2-hydroxypropyl)benzene-1,2-diol |
| SMILES | CC(O)Cc1c(F)ccc(O)c1O |
| InChI | InChI=1S/C9H11FO3/c1-5(11)4-6-7(10)2-3-8(12)9(6)13/h2-3,5,11-13H,4H2,1H3 |
| InChIKey | KORAIEJRDXOKRA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|