C10H13F2NO — CID 174763892
1-[2-(aminomethyl)-3,4-difluorophenyl]propan-2-ol (PubChem CID 174763892) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-3,4-difluorophenyl]propan-2-ol.
| Compound Name | 1-[2-(aminomethyl)-3,4-difluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 174763892 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-[2-(aminomethyl)-3,4-difluorophenyl]propan-2-ol |
| SMILES | CC(O)Cc1ccc(F)c(F)c1CN |
| InChI | InChI=1S/C10H13F2NO/c1-6(14)4-7-2-3-9(11)10(12)8(7)5-13/h2-3,6,14H,4-5,13H2,1H3 |
| InChIKey | AQXZBRZNRNPIPA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |