C11H18N2O — CID 101292367
1-[2,3-bis(aminomethyl)phenyl]propan-2-ol (PubChem CID 101292367) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-[2,3-bis(aminomethyl)phenyl]propan-2-ol.
| Compound Name | 1-[2,3-bis(aminomethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 101292367 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-[2,3-bis(aminomethyl)phenyl]propan-2-ol |
| SMILES | CC(O)Cc1cccc(CN)c1CN |
| InChI | InChI=1S/C11H18N2O/c1-8(14)5-9-3-2-4-10(6-12)11(9)7-13/h2-4,8,14H,5-7,12-13H2,1H3 |
| InChIKey | BZSYHQVJUWHCJB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |