C14H24N2O2 — CID 101292380
1-[3,4-bis(aminomethyl)-5-(2-hydroxypropyl)phenyl]propan-2-ol (PubChem CID 101292380) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-[3,4-bis(aminomethyl)-5-(2-hydroxypropyl)phenyl]propan-2-ol.
| Compound Name | 1-[3,4-bis(aminomethyl)-5-(2-hydroxypropyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 101292380 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1-[3,4-bis(aminomethyl)-5-(2-hydroxypropyl)phenyl]propan-2-ol |
| SMILES | CC(O)Cc1cc(CN)c(CN)c(CC(C)O)c1 |
| InChI | InChI=1S/C14H24N2O2/c1-9(17)3-11-5-12(4-10(2)18)14(8-16)13(6-11)7-15/h5-6,9-10,17-18H,3-4,7-8,15-16H2,1-2H3 |
| InChIKey | FZQCUPURVABJIP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |