C17H30N2O3 — CID 101292408
1-[3-(aminomethyl)-5-(2-hydroxypropyl)-4-[(2-hydroxypropylamino)methyl]phenyl]propan-2-ol (PubChem CID 101292408) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-5-(2-hydroxypropyl)-4-[(2-hydroxypropylamino)methyl]phenyl]propan-2-ol.
| Compound Name | 1-[3-(aminomethyl)-5-(2-hydroxypropyl)-4-[(2-hydroxypropylamino)methyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 101292408 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 1-[3-(aminomethyl)-5-(2-hydroxypropyl)-4-[(2-hydroxypropylamino)methyl]phenyl]propan-2-ol |
| SMILES | CC(O)CNCc1c(CN)cc(CC(C)O)cc1CC(C)O |
| InChI | InChI=1S/C17H30N2O3/c1-11(20)4-14-6-15(5-12(2)21)17(16(7-14)8-18)10-19-9-13(3)22/h6-7,11-13,19-22H,4-5,8-10,18H2,1-3H3 |
| InChIKey | AQZBOHYCLWXTQL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |