C18H36N6O — CID 122573668
2,4,6-tris[(2-aminopropylamino)methyl]phenol (PubChem CID 122573668) has the molecular formula C18H36N6O and a molecular weight of 352.53 g/mol. Its IUPAC name is 2,4,6-tris[(2-aminopropylamino)methyl]phenol.
| Compound Name | 2,4,6-tris[(2-aminopropylamino)methyl]phenol |
|---|---|
| PubChem CID | 122573668 |
| Molecular Formula | C18H36N6O |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 2,4,6-tris[(2-aminopropylamino)methyl]phenol |
| SMILES | CC(N)CNCc1cc(CNCC(C)N)c(O)c(CNCC(C)N)c1 |
| InChI | InChI=1S/C18H36N6O/c1-12(19)6-22-9-15-4-16(10-23-7-13(2)20)18(25)17(5-15)11-24-8-14(3)21/h4-5,12-14,22-25H,6-11,19-21H2,1-3H3 |
| InChIKey | YSEXHNGQUOPFME-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|