C13H22N2 — CID 115196543
1-N-[(2,4,5-trimethylphenyl)methyl]propane-1,2-diamine (PubChem CID 115196543) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-N-[(2,4,5-trimethylphenyl)methyl]propane-1,2-diamine.
| Compound Name | 1-N-[(2,4,5-trimethylphenyl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 115196543 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-N-[(2,4,5-trimethylphenyl)methyl]propane-1,2-diamine |
| SMILES | Cc1cc(C)c(CNCC(C)N)cc1C |
| InChI | InChI=1S/C13H22N2/c1-9-5-11(3)13(6-10(9)2)8-15-7-12(4)14/h5-6,12,15H,7-8,14H2,1-4H3 |
| InChIKey | FAIYTVQJTFXHOR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |